Products 1549003-90-8

CAS 1549003-90-8 is the registry number for 2-Cyclopropyl-3-(2-methoxyphenyl)-2-methylpropanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-cyclopropyl-3-(2-methoxyphenyl)-2-methylpropanoic acid (CAS 1549003-90-8) is a chemical compound with the molecular formula C14H18O3 and a molecular weight of 234.29 g/mol. IUPAC name: 2-cyclopropyl-3-(2-methoxyphenyl)-2-methylpropanoic acid. InChIKey: QZVRNSXAXVIUPH-UHFFFAOYSA-N.

Identity
Molecular formulaC14H18O3
Molecular weight234.29 g/mol
IUPAC name2-cyclopropyl-3-(2-methoxyphenyl)-2-methylpropanoic acid
InChIKeyQZVRNSXAXVIUPH-UHFFFAOYSA-N
SMILESCC(CC1=CC=CC=C1OC)(C2CC2)C(=O)O

Computed by PubChem (NCBI)