CAS 1551135-48-8 appears in our catalog under these names: 1-(2,2-Difluoroethyl)-2-oxo-1,2-dihydropyridine-4-carboxylic acid, 95%, 1-(2,2-Difluoroethyl)-2-oxo-1,2-dihydropyridine-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
1-(2,2-difluoroethyl)-2-oxopyridine-4-carboxylic acid (CAS 1551135-48-8) is a chemical compound with the molecular formula C8H7F2NO3 and a molecular weight of 203.14 g/mol. IUPAC name: 1-(2,2-difluoroethyl)-2-oxopyridine-4-carboxylic acid. InChIKey: WQCMQHMYKKUFTM-UHFFFAOYSA-N.
| Molecular formula | C8H7F2NO3 |
|---|---|
| Molecular weight | 203.14 g/mol |
| IUPAC name | 1-(2,2-difluoroethyl)-2-oxopyridine-4-carboxylic acid |
| InChIKey | WQCMQHMYKKUFTM-UHFFFAOYSA-N |
| SMILES | C1=CN(C(=O)C=C1C(=O)O)CC(F)F |
Computed by PubChem (NCBI)