CAS 155222-48-3 appears in our catalog under these names: 3,5-Diacetoxy Styrene, 5–Vinyl–1,3–phenylene diacetate. Offered by: TRC, GLPBio. Available pack sizes: 10mg, 25mg, 50mg, 5g.
(3-acetyloxy-5-ethenylphenyl) acetate (CAS 155222-48-3) is a chemical compound with the molecular formula C12H12O4 and a molecular weight of 220.22 g/mol. IUPAC name: (3-acetyloxy-5-ethenylphenyl) acetate. InChIKey: JEKQGWWKEWSQCU-UHFFFAOYSA-N.
| Molecular formula | C12H12O4 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | (3-acetyloxy-5-ethenylphenyl) acetate |
| InChIKey | JEKQGWWKEWSQCU-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC(=CC(=C1)C=C)OC(=O)C |
Computed by PubChem (NCBI)