Products 1552269-44-9

CAS 1552269-44-9 is the registry number for Ethyl 3-fluoroindole-2-carboxylate. Offered by: Biosynth. Available pack sizes: 2g, 5g, 10g, 25g.

Structural formula: {0} (CAS {1})

Ethyl 3-fluoro-1H-indole-2-carboxylate (CAS 1552269-44-9) is a chemical compound with the molecular formula C11H10FNO2 and a molecular weight of 207.20 g/mol. IUPAC name: ethyl 3-fluoro-1H-indole-2-carboxylate. InChIKey: JFQGDSICMDTBII-UHFFFAOYSA-N.

Identity
Molecular formulaC11H10FNO2
Molecular weight207.20 g/mol
IUPAC nameethyl 3-fluoro-1H-indole-2-carboxylate
InChIKeyJFQGDSICMDTBII-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C(C2=CC=CC=C2N1)F

Computed by PubChem (NCBI)