CAS 1552688-63-7 appears in our catalog under these names: 3-(2-Chloro-6-fluorophenoxy)propanoic acid, 95%, 3-(2-Chloro-6-fluorophenoxy)propanoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 50mg, 0,5g.
3-(2-chloro-6-fluorophenoxy)propanoic acid (CAS 1552688-63-7) is a chemical compound with the molecular formula C9H8ClFO3 and a molecular weight of 218.61 g/mol. IUPAC name: 3-(2-chloro-6-fluorophenoxy)propanoic acid. InChIKey: PLPOCQPLQSHUBI-UHFFFAOYSA-N.
| Molecular formula | C9H8ClFO3 |
|---|---|
| Molecular weight | 218.61 g/mol |
| IUPAC name | 3-(2-chloro-6-fluorophenoxy)propanoic acid |
| InChIKey | PLPOCQPLQSHUBI-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)OCCC(=O)O)F |
Computed by PubChem (NCBI)