CAS 1552760-28-7 is the registry number for 2-((5-Fluoro-2-nitrophenoxy)methyl)-1,3-dimethylbenzene, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
2-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-dimethylbenzene (CAS 1552760-28-7) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: 2-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-dimethylbenzene. InChIKey: AYFCVGCDTLNTPN-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO3 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | 2-[(5-fluoro-2-nitrophenoxy)methyl]-1,3-dimethylbenzene |
| InChIKey | AYFCVGCDTLNTPN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)COC2=C(C=CC(=C2)F)[N+](=O)[O-] |
Computed by PubChem (NCBI)