CAS 363162-31-6 is the registry number for 4-Fluoro-N-(3,4-dimethoxyphenyl)benzamide, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.
N-(3,4-dimethoxyphenyl)-4-fluorobenzamide (CAS 363162-31-6) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: N-(3,4-dimethoxyphenyl)-4-fluorobenzamide. InChIKey: INWLLDZVACSMTD-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO3 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | N-(3,4-dimethoxyphenyl)-4-fluorobenzamide |
| InChIKey | INWLLDZVACSMTD-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)NC(=O)C2=CC=C(C=C2)F)OC |
Computed by PubChem (NCBI)