CAS 875702-44-6 is the registry number for Methyl 2-(4-(4-amino-2-fluorophenoxy)phenyl)acetate, 97%. Offered by: Ambeed. Available pack sizes: 1g, 5g.
Methyl 2-[4-(4-amino-2-fluorophenoxy)phenyl]acetate (CAS 875702-44-6) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: methyl 2-[4-(4-amino-2-fluorophenoxy)phenyl]acetate. InChIKey: CXGXQZHNPAGEJI-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO3 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | methyl 2-[4-(4-amino-2-fluorophenoxy)phenyl]acetate |
| InChIKey | CXGXQZHNPAGEJI-UHFFFAOYSA-N |
| SMILES | COC(=O)CC1=CC=C(C=C1)OC2=C(C=C(C=C2)N)F |
Computed by PubChem (NCBI)