Products 478048-64-5

CAS 478048-64-5 is the registry number for Ethyl 1-allyl-7-fluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate (CAS 478048-64-5) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: ethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate. InChIKey: OWQUBNGQUCCLDI-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14FNO3
Molecular weight275.27 g/mol
IUPAC nameethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate
InChIKeyOWQUBNGQUCCLDI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=CN(C2=C(C1=O)C=CC(=C2)F)CC=C

Computed by PubChem (NCBI)