CAS 478048-64-5 is the registry number for Ethyl 1-allyl-7-fluoro-4-oxo-1,4-dihydro-3-quinolinecarboxylate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
Ethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate (CAS 478048-64-5) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: ethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate. InChIKey: OWQUBNGQUCCLDI-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO3 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | ethyl 7-fluoro-4-oxo-1-prop-2-enylquinoline-3-carboxylate |
| InChIKey | OWQUBNGQUCCLDI-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CN(C2=C(C1=O)C=CC(=C2)F)CC=C |
Computed by PubChem (NCBI)