CAS 91618-36-9 appears in our catalog under these names: Ibafloxacine, 98%, Ibafloxacine, Ibafloxacin. Offered by: Chemat Brand, Hubei YoungXin, Biosynth, Chemat, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 5mg.
7-fluoro-8,12-dimethyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid (CAS 91618-36-9) is a chemical compound with the molecular formula C15H14FNO3 and a molecular weight of 275.27 g/mol. IUPAC name: 7-fluoro-8,12-dimethyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid. InChIKey: DXKRGNXUIRKXNR-UHFFFAOYSA-N.
| Molecular formula | C15H14FNO3 |
|---|---|
| Molecular weight | 275.27 g/mol |
| IUPAC name | 7-fluoro-8,12-dimethyl-4-oxo-1-azatricyclo[7.3.1.05,13]trideca-2,5,7,9(13)-tetraene-3-carboxylic acid |
| InChIKey | DXKRGNXUIRKXNR-UHFFFAOYSA-N |
| SMILES | CC1CCC2=C3N1C=C(C(=O)C3=CC(=C2C)F)C(=O)O |
Computed by PubChem (NCBI)