Products 155347-34-5
CAS 155347-34-5 is the registry number for 3-Mesitylpentanedioic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(2,4,6-trimethylphenyl)pentanedioic acid (CAS 155347-34-5) is a chemical compound with the molecular formula C14H18O4 and a molecular weight of 250.29 g/mol. IUPAC name: 3-(2,4,6-trimethylphenyl)pentanedioic acid. InChIKey: HOZYCNJWYKLNGE-UHFFFAOYSA-N.
| Molecular formula | C14H18O4 |
|---|---|
| Molecular weight | 250.29 g/mol |
| IUPAC name | 3-(2,4,6-trimethylphenyl)pentanedioic acid |
| InChIKey | HOZYCNJWYKLNGE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)C(CC(=O)O)CC(=O)O)C |
Computed by PubChem (NCBI)