CAS 155395-45-2 is the registry number for 2-(2-Furyl)benzonitrile, 97% . Offered by: Thermo Scientific. Available pack sizes: 250MG, 1g.
2-(furan-2-yl)benzonitrile (CAS 155395-45-2) is a chemical compound with the molecular formula C11H7NO and a molecular weight of 169.18 g/mol. IUPAC name: 2-(furan-2-yl)benzonitrile. InChIKey: XLZNEBADSPRURH-UHFFFAOYSA-N.
| Molecular formula | C11H7NO |
|---|---|
| Molecular weight | 169.18 g/mol |
| IUPAC name | 2-(furan-2-yl)benzonitrile |
| InChIKey | XLZNEBADSPRURH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C#N)C2=CC=CO2 |
Computed by PubChem (NCBI)