CAS 15540-79-1 appears in our catalog under these names: Acetylsalicylic Acid Impurity 3, 4-Amino-6-hydroxy-1,3-benzenedicarboxylic Acid, >95% (HPLC), 4-Amino-6-hydroxybenzene-1,3-dicarboxylic acid, 4-Amino-6-hydroxybenzene-1,3-dicarboxylic acid 95%, 4-Amino-6-hydroxy-1,3-benzenedicarboxylic Acid, 95%, 95%. Offered by: Chemat Brand, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: on request, 25mg, 50mg, 5mg, 0,5g, 100mg, 250mg, 1g.
4-amino-6-hydroxybenzene-1,3-dicarboxylic acid (CAS 15540-79-1) is a chemical compound with the molecular formula C8H7NO5 and a molecular weight of 197.14 g/mol. IUPAC name: 4-amino-6-hydroxybenzene-1,3-dicarboxylic acid. InChIKey: BLBBHFYLFBKYNA-UHFFFAOYSA-N.
| Molecular formula | C8H7NO5 |
|---|---|
| Molecular weight | 197.14 g/mol |
| IUPAC name | 4-amino-6-hydroxybenzene-1,3-dicarboxylic acid |
| InChIKey | BLBBHFYLFBKYNA-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1C(=O)O)O)N)C(=O)O |
Computed by PubChem (NCBI)