CAS 155403-94-4 is the registry number for N-Boc-N-methyl-4-methoxy-D-phenylalanine, 95%. Offered by: AmBeed. Available pack sizes: 1g.
(2R)-3-(4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid (CAS 155403-94-4) is a chemical compound with the molecular formula C16H23NO5 and a molecular weight of 309.36 g/mol. IUPAC name: (2R)-3-(4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid. InChIKey: GVPXAJMOULURAZ-CYBMUJFWSA-N.
| Molecular formula | C16H23NO5 |
|---|---|
| Molecular weight | 309.36 g/mol |
| IUPAC name | (2R)-3-(4-methoxyphenyl)-2-[methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]propanoic acid |
| InChIKey | GVPXAJMOULURAZ-CYBMUJFWSA-N |
| SMILES | CC(C)(C)OC(=O)N(C)[C@H](CC1=CC=C(C=C1)OC)C(=O)O |
Computed by PubChem (NCBI)