Products 155418-97-6
CAS 155418-97-6 is the registry number for 4,5-Dihydroblumenol A. Offered by: Biosynth, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 25mg, 10mg, Get quote.
Cis-(4S,5R)-4-hydroxy-4-[(E,3R)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one (CAS 155418-97-6) is a chemical compound with the molecular formula C13H22O3 and a molecular weight of 226.31 g/mol. IUPAC name: cis-(4S,5R)-4-hydroxy-4-[(E,3R)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one. InChIKey: IHDJYDVWNNFPHR-CHESLIBASA-N.
| Molecular formula | C13H22O3 |
|---|---|
| Molecular weight | 226.31 g/mol |
| IUPAC name | cis-(4S,5R)-4-hydroxy-4-[(E,3R)-3-hydroxybut-1-enyl]-3,3,5-trimethylcyclohexan-1-one |
| InChIKey | IHDJYDVWNNFPHR-CHESLIBASA-N |
| SMILES | C[C@@H]1CC(=O)CC([C@]1(/C=C/[C@@H](C)O)O)(C)C |
Computed by PubChem (NCBI)