Products 155431-32-6
CAS 155431-32-6 is the registry number for 1,2-Dihydro-2-[4-(trifluoromethyl)phenyl]-3H-1,2,4-triazol-3-one, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
2-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one (CAS 155431-32-6) is a chemical compound with the molecular formula C9H6F3N3O and a molecular weight of 229.16 g/mol. IUPAC name: 2-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one. InChIKey: ZLJRTJHTFTZJHJ-UHFFFAOYSA-N.
| Molecular formula | C9H6F3N3O |
|---|---|
| Molecular weight | 229.16 g/mol |
| IUPAC name | 2-[4-(trifluoromethyl)phenyl]-4H-1,2,4-triazol-3-one |
| InChIKey | ZLJRTJHTFTZJHJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)N2C(=O)NC=N2 |
Computed by PubChem (NCBI)