Products 1555769-22-6
CAS 1555769-22-6 is the registry number for tert-Butyl 2-amino-4-(4-methoxyphenyl)thiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Tert-butyl 2-amino-4-(4-methoxyphenyl)thiophene-3-carboxylate (CAS 1555769-22-6) is a chemical compound with the molecular formula C16H19NO3S and a molecular weight of 305.4 g/mol. IUPAC name: tert-butyl 2-amino-4-(4-methoxyphenyl)thiophene-3-carboxylate. InChIKey: CALDLPBXNRYYLX-UHFFFAOYSA-N.
| Molecular formula | C16H19NO3S |
|---|---|
| Molecular weight | 305.4 g/mol |
| IUPAC name | tert-butyl 2-amino-4-(4-methoxyphenyl)thiophene-3-carboxylate |
| InChIKey | CALDLPBXNRYYLX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC=C1C2=CC=C(C=C2)OC)N |
Computed by PubChem (NCBI)