Products 1556051-01-4
CAS 1556051-01-4 is the registry number for 1,4-Dimethyl-1H-pyrrolo(2,3-b)pyridine-3-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.
1,4-dimethylpyrrolo[2,3-b]pyridine-3-carboxylic acid (CAS 1556051-01-4) is a chemical compound with the molecular formula C10H10N2O2 and a molecular weight of 190.20 g/mol. IUPAC name: 1,4-dimethylpyrrolo[2,3-b]pyridine-3-carboxylic acid. InChIKey: DGIKILURKUVJLH-UHFFFAOYSA-N.
| Molecular formula | C10H10N2O2 |
|---|---|
| Molecular weight | 190.20 g/mol |
| IUPAC name | 1,4-dimethylpyrrolo[2,3-b]pyridine-3-carboxylic acid |
| InChIKey | DGIKILURKUVJLH-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CN(C2=NC=C1)C)C(=O)O |
Computed by PubChem (NCBI)