Products 1556208-90-2
CAS 1556208-90-2 is the registry number for tert-Butyl 2-amino-4-(1-methyl-1H-pyrazol-4-yl)thiophene-3-carboxylate. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
Tert-butyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate (CAS 1556208-90-2) is a chemical compound with the molecular formula C13H17N3O2S and a molecular weight of 279.36 g/mol. IUPAC name: tert-butyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate. InChIKey: JMJQSYLXZANPPJ-UHFFFAOYSA-N.
| Molecular formula | C13H17N3O2S |
|---|---|
| Molecular weight | 279.36 g/mol |
| IUPAC name | tert-butyl 2-amino-4-(1-methylpyrazol-4-yl)thiophene-3-carboxylate |
| InChIKey | JMJQSYLXZANPPJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(SC=C1C2=CN(N=C2)C)N |
Computed by PubChem (NCBI)