CAS 155666-94-7 appears in our catalog under these names: Rasagiline Impurity 20, (-)-N-Trifluoroacetyl-1-aminoindan. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 250mg.
N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,2,2-trifluoroacetamide (CAS 155666-94-7) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,2,2-trifluoroacetamide. InChIKey: YUPHAYFQAVLCRV-SECBINFHSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | N-[(1R)-2,3-dihydro-1H-inden-1-yl]-2,2,2-trifluoroacetamide |
| InChIKey | YUPHAYFQAVLCRV-SECBINFHSA-N |
| SMILES | C1CC2=CC=CC=C2[C@@H]1NC(=O)C(F)(F)F |
Computed by PubChem (NCBI)