CAS 15568-87-3 is the registry number for Formyl Meldrum’s Acid. Offered by: TRC. Available pack sizes: 10mg, 25mg, 50mg.
5-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione (CAS 15568-87-3) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 5-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione. InChIKey: DELRMBDZSMPFPS-UHFFFAOYSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 5-(hydroxymethylidene)-2,2-dimethyl-1,3-dioxane-4,6-dione |
| InChIKey | DELRMBDZSMPFPS-UHFFFAOYSA-N |
| SMILES | CC1(OC(=O)C(=CO)C(=O)O1)C |
Computed by PubChem (NCBI)