CAS 67885-97-6 appears in our catalog under these names: Trans-dl-4-oxo-cyclopentane-1,2-dicarboxylic acid, 95%, rel-(1R,2R)-4-Oxo-1,2-cyclopentanedicarboxylic acid, 98%, 98%, trans-4-Oxocyclopentane-1,2-dicarboxylic acid, 95%. Offered by: Combi-blocks, Chemat, Ambeed. Available pack sizes: 10g, 5g, 1g, 100mg, 250mg, 25g, 50g, 100g.
Trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid (CAS 67885-97-6) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid. InChIKey: CJSMOECOKYPHSC-RFZPGFLSSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | trans-(1R,2R)-4-oxocyclopentane-1,2-dicarboxylic acid |
| InChIKey | CJSMOECOKYPHSC-RFZPGFLSSA-N |
| SMILES | C1[C@H]([C@@H](CC1=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)