CAS 1703-61-3 appears in our catalog under these names: 4-Oxocyclopentane-1,2-dicarboxylic acid, 97%, 97%, 4-Oxocyclopentane-1,2-dicarboxylic acid, 95%, 4-Oxocyclopentane-1,2-dicarboxylic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g.
4-oxocyclopentane-1,2-dicarboxylic acid (CAS 1703-61-3) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 4-oxocyclopentane-1,2-dicarboxylic acid. InChIKey: CJSMOECOKYPHSC-UHFFFAOYSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 4-oxocyclopentane-1,2-dicarboxylic acid |
| InChIKey | CJSMOECOKYPHSC-UHFFFAOYSA-N |
| SMILES | C1C(C(CC1=O)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)