Products 188525-95-3

CAS 188525-95-3 is the registry number for 2-Oxo-5-propyl-1,3-dioxole-4-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

2-oxo-5-propyl-1,3-dioxole-4-carboxylic acid (CAS 188525-95-3) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 2-oxo-5-propyl-1,3-dioxole-4-carboxylic acid. InChIKey: IJOSIDWDFQWDHU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O5
Molecular weight172.13 g/mol
IUPAC name2-oxo-5-propyl-1,3-dioxole-4-carboxylic acid
InChIKeyIJOSIDWDFQWDHU-UHFFFAOYSA-N
SMILESCCCC1=C(OC(=O)O1)C(=O)O

Computed by PubChem (NCBI)