CAS 188525-84-0 is the registry number for 5-Isopropyl-2-oxo-1,3-dioxole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid (CAS 188525-84-0) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid. InChIKey: GBOTXQHVKOUJFL-UHFFFAOYSA-N.
| Molecular formula | C7H8O5 |
|---|---|
| Molecular weight | 172.13 g/mol |
| IUPAC name | 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid |
| InChIKey | GBOTXQHVKOUJFL-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(OC(=O)O1)C(=O)O |
Computed by PubChem (NCBI)