Products 188525-84-0

CAS 188525-84-0 is the registry number for 5-Isopropyl-2-oxo-1,3-dioxole-4-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid (CAS 188525-84-0) is a chemical compound with the molecular formula C7H8O5 and a molecular weight of 172.13 g/mol. IUPAC name: 2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid. InChIKey: GBOTXQHVKOUJFL-UHFFFAOYSA-N.

Identity
Molecular formulaC7H8O5
Molecular weight172.13 g/mol
IUPAC name2-oxo-5-propan-2-yl-1,3-dioxole-4-carboxylic acid
InChIKeyGBOTXQHVKOUJFL-UHFFFAOYSA-N
SMILESCC(C)C1=C(OC(=O)O1)C(=O)O

Computed by PubChem (NCBI)