CAS 155683-59-3 appears in our catalog under these names: Levonorgestrel EP Impurity W, Levonorgestrel Impurity 23(Levonorgestrel EP Impurity W), Δ5(10),6,8(9)-D-(-)-Norgestrel, >95% (HPLC). Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, 0,5mg, 1mg.
(13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,4,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one (CAS 155683-59-3) is a chemical compound with the molecular formula C21H24O2 and a molecular weight of 308.4 g/mol. IUPAC name: (13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,4,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one. InChIKey: WWHYYFPSWOYNJF-ACRUOGEOSA-N.
| Molecular formula | C21H24O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | (13S,14S,17R)-13-ethyl-17-ethynyl-17-hydroxy-1,2,4,11,12,14,15,16-octahydrocyclopenta[a]phenanthren-3-one |
| InChIKey | WWHYYFPSWOYNJF-ACRUOGEOSA-N |
| SMILES | CC[C@]12CCC3=C([C@@H]1CC[C@]2(C#C)O)C=CC4=C3CCC(=O)C4 |
Computed by PubChem (NCBI)