CAS 1745-89-7 appears in our catalog under these names: 2,2′–Diallylbisphenol A, 4-{2-(4-Hydroxy-3-(prop-2-en-1-yl)phenyl)propan-2-yl}-2-(prop-2-en-1-yl)phenol, 2,2'-Diallylbisphenol A, >84.0%(GC), 4,4'-(Propane-2,2-diyl)bis(2-allylphenol) 90%, 2,2'-DIALLYLBISPHENOL A, TECH., 85%. Offered by: GLPBio, Biosynth, TCI, Ambeed, Sigma-Aldrich. Available pack sizes: 500g, 100g, 25g, 10g, 1000g, 100ML, 1kg.
4-[2-(4-hydroxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenol (CAS 1745-89-7) is a chemical compound with the molecular formula C21H24O2 and a molecular weight of 308.4 g/mol. IUPAC name: 4-[2-(4-hydroxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenol. InChIKey: WOCGGVRGNIEDSZ-UHFFFAOYSA-N.
| Molecular formula | C21H24O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 4-[2-(4-hydroxy-3-prop-2-enylphenyl)propan-2-yl]-2-prop-2-enylphenol |
| InChIKey | WOCGGVRGNIEDSZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC(=C(C=C1)O)CC=C)C2=CC(=C(C=C2)O)CC=C |
Computed by PubChem (NCBI)