Products 56154-59-7
CAS 56154-59-7 is the registry number for Dehydrocannabifuran. Offered by: GLPBio, MedChemExpress. Available pack sizes: 1mg, 5mg, Get quote.
6-methyl-3-pentyl-9-prop-1-en-2-yldibenzofuran-1-ol (CAS 56154-59-7) is a chemical compound with the molecular formula C21H24O2 and a molecular weight of 308.4 g/mol. IUPAC name: 6-methyl-3-pentyl-9-prop-1-en-2-yldibenzofuran-1-ol. InChIKey: NAGBBYZBIQVPIQ-UHFFFAOYSA-N.
| Molecular formula | C21H24O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 6-methyl-3-pentyl-9-prop-1-en-2-yldibenzofuran-1-ol |
| InChIKey | NAGBBYZBIQVPIQ-UHFFFAOYSA-N |
| SMILES | CCCCCC1=CC(=C2C(=C1)OC3=C(C=CC(=C23)C(=C)C)C)O |
Computed by PubChem (NCBI)