CAS 1568-80-5 appears in our catalog under these names: 3,3,3',3'-Tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol, 95%, HIV-1 integrase inhibitor 8/ 98.01% (existing batch purity), HIV–1 integrase inhibitor 8, 3,3,3',3'-Tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol, >95.0%(HPLC)(qNMR), 3,3,3',3'-Tetramethyl-2,2',3,3'-tetrahydro-1,1'-spirobi[indene]-6,6'-diol, 98%, 98%. Offered by: Combi-blocks, TargetMol, GLPBio, TCI, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 200mg, 500mg, 50mg, 10mM/1mL.
1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol (CAS 1568-80-5) is a chemical compound with the molecular formula C21H24O2 and a molecular weight of 308.4 g/mol. IUPAC name: 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol. InChIKey: SICLLPHPVFCNTJ-UHFFFAOYSA-N.
| Molecular formula | C21H24O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 1,1,1',1'-tetramethyl-3,3'-spirobi[2H-indene]-5,5'-diol |
| InChIKey | SICLLPHPVFCNTJ-UHFFFAOYSA-N |
| SMILES | CC1(CC2(CC(C3=C2C=C(C=C3)O)(C)C)C4=C1C=CC(=C4)O)C |
Computed by PubChem (NCBI)