CAS 3530-44-7 is the registry number for 2,2'–((Propane–2,2–diylbis(4,1–phenylene))bis(methylene))bis(oxirane). Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
2-[[4-[2-[4-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenyl]methyl]oxirane (CAS 3530-44-7) is a chemical compound with the molecular formula C21H24O2 and a molecular weight of 308.4 g/mol. IUPAC name: 2-[[4-[2-[4-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenyl]methyl]oxirane. InChIKey: XRCKYOARSSVJJM-UHFFFAOYSA-N.
| Molecular formula | C21H24O2 |
|---|---|
| Molecular weight | 308.4 g/mol |
| IUPAC name | 2-[[4-[2-[4-(oxiran-2-ylmethyl)phenyl]propan-2-yl]phenyl]methyl]oxirane |
| InChIKey | XRCKYOARSSVJJM-UHFFFAOYSA-N |
| SMILES | CC(C)(C1=CC=C(C=C1)CC2CO2)C3=CC=C(C=C3)CC4CO4 |
Computed by PubChem (NCBI)