CAS 1556948-67-4 is the registry number for (2S)-2-((1S)-1-Amino-2,2,2-trifluoroethyl)-2,3-dihydro-1H-inden-1-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
(2S)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,3-dihydroinden-1-one (CAS 1556948-67-4) is a chemical compound with the molecular formula C11H10F3NO and a molecular weight of 229.20 g/mol. IUPAC name: (2S)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,3-dihydroinden-1-one. InChIKey: UOYRXIFPAMMXMH-SCZZXKLOSA-N.
| Molecular formula | C11H10F3NO |
|---|---|
| Molecular weight | 229.20 g/mol |
| IUPAC name | (2S)-2-[(1S)-1-amino-2,2,2-trifluoroethyl]-2,3-dihydroinden-1-one |
| InChIKey | UOYRXIFPAMMXMH-SCZZXKLOSA-N |
| SMILES | C1[C@H](C(=O)C2=CC=CC=C21)[C@@H](C(F)(F)F)N |
Computed by PubChem (NCBI)