Products 155721-37-2
CAS 155721-37-2 is the registry number for N-Tosyl-2-(p-nitrophenyl)aziridine, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g.
1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)aziridine (CAS 155721-37-2) is a chemical compound with the molecular formula C15H14N2O4S and a molecular weight of 318.3 g/mol. IUPAC name: 1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)aziridine. InChIKey: KBNDEGGNKFKUEN-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4S |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 1-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)aziridine |
| InChIKey | KBNDEGGNKFKUEN-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2CC2C3=CC=C(C=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)