CAS 891753-65-4 is the registry number for 2-(6-(3,4-Dimethoxyphenyl)imidazo[2,1-b]thiazol-3-yl)acetic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-[6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid (CAS 891753-65-4) is a chemical compound with the molecular formula C15H14N2O4S and a molecular weight of 318.3 g/mol. IUPAC name: 2-[6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid. InChIKey: KMGIKWVWCRMJKZ-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4S |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 2-[6-(3,4-dimethoxyphenyl)imidazo[2,1-b][1,3]thiazol-3-yl]acetic acid |
| InChIKey | KMGIKWVWCRMJKZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C2=CN3C(=CSC3=N2)CC(=O)O)OC |
Computed by PubChem (NCBI)