Products 33477-97-3
CAS 33477-97-3 appears in our catalog under these names: Ceftizoxime Impurity 46, Ceftizoxime Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
(6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid (CAS 33477-97-3) is a chemical compound with the molecular formula C15H14N2O4S and a molecular weight of 318.3 g/mol. IUPAC name: (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid. InChIKey: LSNNJFPAIWHDGA-TZMCWYRMSA-N.
| Molecular formula | C15H14N2O4S |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | (6R,7R)-8-oxo-7-[(2-phenylacetyl)amino]-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylic acid |
| InChIKey | LSNNJFPAIWHDGA-TZMCWYRMSA-N |
| SMILES | C1C=C(N2[C@H](S1)[C@@H](C2=O)NC(=O)CC3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)