CAS 2130852-65-0 is the registry number for Belinostat-d5. Offered by: Chemat Brand, Hubei YoungXin, TRC, MedChemExpress. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg, Get quote.
(E)-N-hydroxy-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enamide (CAS 2130852-65-0) is a chemical compound with the molecular formula C15H14N2O4S and a molecular weight of 323.4 g/mol. IUPAC name: (E)-N-hydroxy-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enamide. InChIKey: NCNRHFGMJRPRSK-HMUIAXRESA-N.
| Molecular formula | C15H14N2O4S |
|---|---|
| Molecular weight | 323.4 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[3-[(2,3,4,5,6-pentadeuteriophenyl)sulfamoyl]phenyl]prop-2-enamide |
| InChIKey | NCNRHFGMJRPRSK-HMUIAXRESA-N |
| SMILES | [2H]C1=C(C(=C(C(=C1[2H])[2H])NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)NO)[2H])[2H] |
Computed by PubChem (NCBI)