CAS 63470-85-9 is the registry number for 1-Nitro Febantel. Offered by: TRC. Available pack sizes: 10g.
2-methoxy-N-(2-nitro-5-phenylsulfanylphenyl)acetamide (CAS 63470-85-9) is a chemical compound with the molecular formula C15H14N2O4S and a molecular weight of 318.3 g/mol. IUPAC name: 2-methoxy-N-(2-nitro-5-phenylsulfanylphenyl)acetamide. InChIKey: LBHWUDRAIQBYHH-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O4S |
|---|---|
| Molecular weight | 318.3 g/mol |
| IUPAC name | 2-methoxy-N-(2-nitro-5-phenylsulfanylphenyl)acetamide |
| InChIKey | LBHWUDRAIQBYHH-UHFFFAOYSA-N |
| SMILES | COCC(=O)NC1=C(C=CC(=C1)SC2=CC=CC=C2)[N+](=O)[O-] |
Computed by PubChem (NCBI)