CAS 155760-00-2 appears in our catalog under these names: (S)-alpha-Amino-2-anthracenepropanoic Acid, H-L-Ala(2-Anth)-OH. Offered by: TRC, Iris Biotech. Available pack sizes: 50mg, 250mg.
(2S)-2-amino-3-anthracen-2-ylpropanoic acid (CAS 155760-00-2) is a chemical compound with the molecular formula C17H15NO2 and a molecular weight of 265.31 g/mol. IUPAC name: (2S)-2-amino-3-anthracen-2-ylpropanoic acid. InChIKey: IXSDAIHAHNXSEH-INIZCTEOSA-N.
| Molecular formula | C17H15NO2 |
|---|---|
| Molecular weight | 265.31 g/mol |
| IUPAC name | (2S)-2-amino-3-anthracen-2-ylpropanoic acid |
| InChIKey | IXSDAIHAHNXSEH-INIZCTEOSA-N |
| SMILES | C1=CC=C2C=C3C=C(C=CC3=CC2=C1)C[C@@H](C(=O)O)N |
Computed by PubChem (NCBI)