CAS 155814-21-4 is the registry number for (E)-3-(6-Bromobenzo[d][1,3]dioxol-5-yl)acrylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid (CAS 155814-21-4) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: (E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid. InChIKey: FIFYPFARGVBVGX-OWOJBTEDSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChIKey | FIFYPFARGVBVGX-OWOJBTEDSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)