CAS 27452-00-2 appears in our catalog under these names: 2-Bromo-4,5-methylenedioxycinnamic acid, 95%, 3-(6-Bromobenzo[d][1,3]dioxol-5-yl)acrylic acid 95% (E), 3-(6-Bromobenzo[d][1,3]dioxol-5-yl)acrylic acid, 95% (E), 95% (E). Offered by: Combi-blocks, Fluorochem, Ambeed, Chemat. Available pack sizes: 1g, 25g, 5g.
(E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid (CAS 27452-00-2) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: (E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid. InChIKey: FIFYPFARGVBVGX-OWOJBTEDSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | (E)-3-(6-bromo-1,3-benzodioxol-5-yl)prop-2-enoic acid |
| InChIKey | FIFYPFARGVBVGX-OWOJBTEDSA-N |
| SMILES | C1OC2=C(O1)C=C(C(=C2)/C=C/C(=O)O)Br |
Computed by PubChem (NCBI)