CAS 16064-90-7 is the registry number for 4-(Bromomethyl)-6,7-dihydroxy-2H-chromen-2-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(bromomethyl)-6,7-dihydroxychromen-2-one (CAS 16064-90-7) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 4-(bromomethyl)-6,7-dihydroxychromen-2-one. InChIKey: NEBDDLWGKAVETN-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 4-(bromomethyl)-6,7-dihydroxychromen-2-one |
| InChIKey | NEBDDLWGKAVETN-UHFFFAOYSA-N |
| SMILES | C1=C(C2=CC(=C(C=C2OC1=O)O)O)CBr |
Computed by PubChem (NCBI)