Products 875830-98-1
CAS 875830-98-1 appears in our catalog under these names: 7-Bromo-5-methoxybenzofuran-2-carboxylic acid, 98%, 7-Bromo-5-methoxybenzofuran-2-carboxylic acid, 95%. Offered by: Chemat, Fluorochem, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g, 5g.
7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid (CAS 875830-98-1) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: LKLZOZCOPJHLSF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | LKLZOZCOPJHLSF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=C(O2)C(=O)O)Br |
Computed by PubChem (NCBI)