Products 875830-98-1
CAS 875830-98-1 is the registry number for 7-Bromo-5-methoxybenzofuran-2-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid (CAS 875830-98-1) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: LKLZOZCOPJHLSF-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 7-bromo-5-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | LKLZOZCOPJHLSF-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C2C(=C1)C=C(O2)C(=O)O)Br |
Computed by PubChem (NCBI)