CAS 20073-19-2 appears in our catalog under these names: 5–Bromo–6–methoxybenzofuran–2–carboxylic acid, 5-Bromo-6-methoxybenzofuran-2-carboxylic acid, 95%, 5-Bromo-6-methoxybenzofuran-2-carboxylic acid, 97%, 5-bromo-6-methoxybenzofuran-2-carboxylic acid, 97%, 97%. Offered by: GLPBio, Combi-blocks, AmBeed, Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 5g, 1g, 10g.
5-bromo-6-methoxy-1-benzofuran-2-carboxylic acid (CAS 20073-19-2) is a chemical compound with the molecular formula C10H7BrO4 and a molecular weight of 271.06 g/mol. IUPAC name: 5-bromo-6-methoxy-1-benzofuran-2-carboxylic acid. InChIKey: RKNWDMISPSACLI-UHFFFAOYSA-N.
| Molecular formula | C10H7BrO4 |
|---|---|
| Molecular weight | 271.06 g/mol |
| IUPAC name | 5-bromo-6-methoxy-1-benzofuran-2-carboxylic acid |
| InChIKey | RKNWDMISPSACLI-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C2C=C(OC2=C1)C(=O)O)Br |
Computed by PubChem (NCBI)