Products 155877-84-2

CAS 155877-84-2 is the registry number for 4-(Methoxycarbonyl)-b-oxo-benzenepropanoic acid ethyl ester, 95%. Offered by: AmBeed. Available pack sizes: 1g.

Methyl 4-(3-ethoxy-3-oxopropanoyl)benzoate (CAS 155877-84-2) is a chemical compound with the molecular formula C13H14O5 and a molecular weight of 250.25 g/mol. IUPAC name: methyl 4-(3-ethoxy-3-oxopropanoyl)benzoate. InChIKey: GFDCYWYWNSTMDX-UHFFFAOYSA-N.

Identity
Molecular formulaC13H14O5
Molecular weight250.25 g/mol
IUPAC namemethyl 4-(3-ethoxy-3-oxopropanoyl)benzoate
InChIKeyGFDCYWYWNSTMDX-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)C1=CC=C(C=C1)C(=O)OC

Computed by PubChem (NCBI)