CAS 155905-77-4 appears in our catalog under these names: (αS)-α-[[(1,1-Dimethylethoxy)carbonyl]amino]cyclobutaneacetic acid, 97%, 97%, Boc-L-cyclobutylglycine, 98.91%, (S)-2-((tert-Butoxycarbonyl)amino)-2-cyclobutylacetic acid, 97%. Offered by: Chemat, MedChemExpress, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 500mg, 100 mg.
(2S)-2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 155905-77-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: (2S)-2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: OHDFGIXTRBDGRB-QMMMGPOBSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | (2S)-2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | OHDFGIXTRBDGRB-QMMMGPOBSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](C1CCC1)C(=O)O |
Computed by PubChem (NCBI)