CAS 811460-95-4 appears in our catalog under these names: 2-((tert-Butoxycarbonyl)amino)-2-cyclobutylacetic acid, 95%, 2-((tert-Butoxycarbonyl)amino)-2-cyclobutylacetic acid, 2-((tert-Butoxycarbonyl)amino)-2-cyclobutylacetic acid, 97%, 97%, 2-((tert-Butoxycarbonyl)amino)-2-cyclobutylacetic acid, 98.0%. Offered by: Fluorochem, Biosynth, Chemat, MedChemExpress. Available pack sizes: 250mg, 1g, 5g, 10g, 2,5g, 100mg, 250 mg, 5 g.
2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid (CAS 811460-95-4) is a chemical compound with the molecular formula C11H19NO4 and a molecular weight of 229.27 g/mol. IUPAC name: 2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid. InChIKey: OHDFGIXTRBDGRB-UHFFFAOYSA-N.
| Molecular formula | C11H19NO4 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-cyclobutyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]acetic acid |
| InChIKey | OHDFGIXTRBDGRB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(C1CCC1)C(=O)O |
Computed by PubChem (NCBI)