CAS 15601-85-1 is the registry number for 2-Amino-4H-1,3-benzothiazin-4-one. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1,3-benzothiazin-4-one (CAS 15601-85-1) is a chemical compound with the molecular formula C8H6N2OS and a molecular weight of 178.21 g/mol. IUPAC name: 2-amino-1,3-benzothiazin-4-one. InChIKey: YIFFDQCDFYGWIB-UHFFFAOYSA-N.
| Molecular formula | C8H6N2OS |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-amino-1,3-benzothiazin-4-one |
| InChIKey | YIFFDQCDFYGWIB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)N=C(S2)N |
Computed by PubChem (NCBI)