CAS 1563216-58-9 appears in our catalog under these names: Methyl 3-(4-fluorophenyl)but-2-enoate, 95%, Methyl 3-(4-fluorophenyl)but-2-enoate. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 1g, 100mg.
Methyl (E)-3-(4-fluorophenyl)but-2-enoate (CAS 1563216-58-9) is a chemical compound with the molecular formula C11H11FO2 and a molecular weight of 194.20 g/mol. IUPAC name: methyl (E)-3-(4-fluorophenyl)but-2-enoate. InChIKey: GNJGRAWNPUCVSX-BQYQJAHWSA-N.
| Molecular formula | C11H11FO2 |
|---|---|
| Molecular weight | 194.20 g/mol |
| IUPAC name | methyl (E)-3-(4-fluorophenyl)but-2-enoate |
| InChIKey | GNJGRAWNPUCVSX-BQYQJAHWSA-N |
| SMILES | C/C(=C\C(=O)OC)/C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)