Products 15637-51-1

CAS 15637-51-1 is the registry number for Ethyl 1-ethyl-4-oxo-3-piperidinecarboxylate hydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

Ethyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride (CAS 15637-51-1) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: ethyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride. InChIKey: ONGKGFKEAAFHLM-UHFFFAOYSA-N.

Identity
Molecular formulaC10H18ClNO3
Molecular weight235.71 g/mol
IUPAC nameethyl 1-ethyl-4-oxopiperidine-3-carboxylate;hydrochloride
InChIKeyONGKGFKEAAFHLM-UHFFFAOYSA-N
SMILESCCN1CCC(=O)C(C1)C(=O)OCC.Cl

Computed by PubChem (NCBI)