CAS 1607249-39-7 appears in our catalog under these names: 2-Amino-2-{5-oxaspiro(3.5)nonan-8-yl}acetic acid hydrochloride, 95%, 2-Amino-2-{5-oxaspiro(3.5)nonan-8-yl}acetic acid hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
2-amino-2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid;hydrochloride (CAS 1607249-39-7) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: 2-amino-2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid;hydrochloride. InChIKey: BBKYCJIMUZXJMK-UHFFFAOYSA-N.
| Molecular formula | C10H18ClNO3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | 2-amino-2-(5-oxaspiro[3.5]nonan-8-yl)acetic acid;hydrochloride |
| InChIKey | BBKYCJIMUZXJMK-UHFFFAOYSA-N |
| SMILES | C1CC2(C1)CC(CCO2)C(C(=O)O)N.Cl |
Computed by PubChem (NCBI)