CAS 93738-78-4 is the registry number for Alloecgonine Methyl Ester Hydrochloride. Offered by: TRC. Available pack sizes: 10mg, 2,5mg, 25mg.
Methyl (1R,2R,3R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride (CAS 93738-78-4) is a chemical compound with the molecular formula C10H18ClNO3 and a molecular weight of 235.71 g/mol. IUPAC name: methyl (1R,2R,3R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride. InChIKey: RLLMNWXOZDXKCQ-WWTDWBKBSA-N.
| Molecular formula | C10H18ClNO3 |
|---|---|
| Molecular weight | 235.71 g/mol |
| IUPAC name | methyl (1R,2R,3R,5S)-3-hydroxy-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate;hydrochloride |
| InChIKey | RLLMNWXOZDXKCQ-WWTDWBKBSA-N |
| SMILES | CN1[C@H]2CC[C@@H]1[C@H]([C@@H](C2)O)C(=O)OC.Cl |
Computed by PubChem (NCBI)